C8H9NO3 — CID 139503576
6-ethenyl-6-nitrocyclohexa-2,4-dien-1-ol (PubChem CID 139503576) has the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. Its IUPAC name is 6-ethenyl-6-nitrocyclohexa-2,4-dien-1-ol.
| Compound Name | 6-ethenyl-6-nitrocyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 139503576 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 6-ethenyl-6-nitrocyclohexa-2,4-dien-1-ol |
| SMILES | C=CC1([N+](=O)[O-])C=CC=CC1O |
| InChI | InChI=1S/C8H9NO3/c1-2-8(9(11)12)6-4-3-5-7(8)10/h2-7,10H,1H2 |
| InChIKey | FCHBRBPJEBBTBL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|