2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid

C10H12O3 — CID 70574562

IUPAC2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid
SMILESC=CC1(O)C=CC=CC1CC(=O)O
InChIInChI=1S/C10H12O3/c1-2-10(13)6-4-3-5-8(10)7-9(11)12/h2-6,8,13H,1,7H2,(H,11,12)
InChIKeyPAYFBDRJANXTGK-UHFFFAOYSA-N
MW180.20 g/mol
LogP1.12
Rot. Bonds3

About 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid

2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 70574562) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid.

Molecular Properties

Compound Name2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid
PubChem CID70574562
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Name2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid
SMILESC=CC1(O)C=CC=CC1CC(=O)O
InChIInChI=1S/C10H12O3/c1-2-10(13)6-4-3-5-8(10)7-9(11)12/h2-6,8,13H,1,7H2,(H,11,12)
InChIKeyPAYFBDRJANXTGK-UHFFFAOYSA-N
XLogP1.12
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid?
The IUPAC name of 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid (CID 70574562) is 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid.
What is the SMILES notation for 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid?
The canonical SMILES for 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid is C=CC1(O)C=CC=CC1CC(=O)O.
What is the InChIKey of 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid?
The InChIKey is PAYFBDRJANXTGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-2-10(13)6-4-3-5-8(10)7-9(11)12/h2-6,8,13H,1,7H2,(H,11,12).
What are the key properties of 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid?
2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid has a molecular weight of 180.20 g/mol, XLogP of 1.12, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid is sourced from PubChem (CID 70574562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).