C10H12O3 — CID 70574562
2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 70574562) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid.
| Compound Name | 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 70574562 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(6-ethenyl-6-hydroxycyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | C=CC1(O)C=CC=CC1CC(=O)O |
| InChI | InChI=1S/C10H12O3/c1-2-10(13)6-4-3-5-8(10)7-9(11)12/h2-6,8,13H,1,7H2,(H,11,12) |
| InChIKey | PAYFBDRJANXTGK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|