C16H18O3 — CID 22253865
2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)-1-phenylethanone (PubChem CID 22253865) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)-1-phenylethanone.
| Compound Name | 2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 22253865 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-(6,6-dimethoxycyclohexa-2,4-dien-1-yl)-1-phenylethanone |
| SMILES | COC1(OC)C=CC=CC1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C16H18O3/c1-18-16(19-2)11-7-6-10-14(16)12-15(17)13-8-4-3-5-9-13/h3-11,14H,12H2,1-2H3 |
| InChIKey | FCVIKWCOHNCOIX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|