C18H22O2 — CID 150394409
2-phenylethyl 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)acetate (PubChem CID 150394409) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-phenylethyl 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)acetate.
| Compound Name | 2-phenylethyl 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)acetate |
|---|---|
| PubChem CID | 150394409 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-phenylethyl 2-(6,6-dimethylcyclohexa-2,4-dien-1-yl)acetate |
| SMILES | CC1(C)C=CC=CC1CC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C18H22O2/c1-18(2)12-7-6-10-16(18)14-17(19)20-13-11-15-8-4-3-5-9-15/h3-10,12,16H,11,13-14H2,1-2H3 |
| InChIKey | HCJWFHKFYFAOSH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |