C17H26O6 — CID 175550836
[6-(hydroxymethyl)-6-methylcyclohexa-2,4-dien-1-yl]methanol;bis(2-methylprop-2-enoic acid) (PubChem CID 175550836) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [6-(hydroxymethyl)-6-methylcyclohexa-2,4-dien-1-yl]methanol;bis(2-methylprop-2-enoic acid).
| Compound Name | [6-(hydroxymethyl)-6-methylcyclohexa-2,4-dien-1-yl]methanol;bis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 175550836 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [6-(hydroxymethyl)-6-methylcyclohexa-2,4-dien-1-yl]methanol;bis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.CC1(CO)C=CC=CC1CO |
| InChI | InChI=1S/C9H14O2.2C4H6O2/c1-9(7-11)5-3-2-4-8(9)6-10;2*1-3(2)4(5)6/h2-5,8,10-11H,6-7H2,1H3;2*1H2,2H3,(H,5,6) |
| InChIKey | XETACAWKTWRSER-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|