About [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol
[(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol (PubChem CID 97304764) has the molecular formula C8H11ClO2
and a molecular weight of 174.63 g/mol. Its IUPAC name is [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol |
| PubChem CID | 97304764 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CO[C@]1(Cl)C=CC=C[C@H]1CO |
| InChI | InChI=1S/C8H11ClO2/c1-11-8(9)5-3-2-4-7(8)6-10/h2-5,7,10H,6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | WLVZFCLGSVUWSF-JGVFFNPUSA-N |
| XLogP | 1.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol?
The IUPAC name of [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol (CID 97304764) is [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol.
What is the SMILES notation for [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol?
The canonical SMILES for [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol is CO[C@]1(Cl)C=CC=C[C@H]1CO.
What is the InChIKey of [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol?
The InChIKey is WLVZFCLGSVUWSF-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H11ClO2/c1-11-8(9)5-3-2-4-7(8)6-10/h2-5,7,10H,6H2,1H3/t7-,8+/m0/s1.
What are the key properties of [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol?
[(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol has a molecular weight of 174.63 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,6S)-6-chloro-6-methoxycyclohexa-2,4-dien-1-yl]methanol is sourced from PubChem (CID 97304764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).