C10H14O4 — CID 151304528
[6-(hydroxymethyl)-1-methoxycyclohexa-2,4-dien-1-yl] acetate (PubChem CID 151304528) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is [6-(hydroxymethyl)-1-methoxycyclohexa-2,4-dien-1-yl] acetate.
| Compound Name | [6-(hydroxymethyl)-1-methoxycyclohexa-2,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 151304528 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | [6-(hydroxymethyl)-1-methoxycyclohexa-2,4-dien-1-yl] acetate |
| SMILES | COC1(OC(C)=O)C=CC=CC1CO |
| InChI | InChI=1S/C10H14O4/c1-8(12)14-10(13-2)6-4-3-5-9(10)7-11/h3-6,9,11H,7H2,1-2H3 |
| InChIKey | ODCXCFIWBFPFLC-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|