C38H32O8 — CID 139807819
bis(1,6-dimethoxycyclohexa-2,4-dien-1-yl) perylene-3,9-dicarboxylate (PubChem CID 139807819) has the molecular formula C38H32O8 and a molecular weight of 616.67 g/mol. Its IUPAC name is bis(1,6-dimethoxycyclohexa-2,4-dien-1-yl) perylene-3,9-dicarboxylate.
| Compound Name | bis(1,6-dimethoxycyclohexa-2,4-dien-1-yl) perylene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 139807819 |
| Molecular Formula | C38H32O8 |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | bis(1,6-dimethoxycyclohexa-2,4-dien-1-yl) perylene-3,9-dicarboxylate |
| SMILES | COC1C=CC=CC1(OC)OC(=O)c1ccc2c3cccc4c(C(=O)OC5(OC)C=CC=CC5OC)ccc(c5cccc1c52)c43 |
| InChI | InChI=1S/C38H32O8/c1-41-31-15-5-7-21-37(31,43-3)45-35(39)29-19-17-27-24-12-10-14-26-30(36(40)46-38(44-4)22-8-6-16-32(38)42-2)20-18-28(34(24)26)23-11-9-13-25(29)33(23)27/h5-22,31-32H,1-4H3 |
| InChIKey | ADHXRHWJLVNLCP-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|