C8H8BrNO4 — CID 86590395
2-(1-bromo-6-nitrocyclohexa-2,4-dien-1-yl)acetic acid (PubChem CID 86590395) has the molecular formula C8H8BrNO4 and a molecular weight of 262.06 g/mol. Its IUPAC name is 2-(1-bromo-6-nitrocyclohexa-2,4-dien-1-yl)acetic acid.
| Compound Name | 2-(1-bromo-6-nitrocyclohexa-2,4-dien-1-yl)acetic acid |
|---|---|
| PubChem CID | 86590395 |
| Molecular Formula | C8H8BrNO4 |
| Molecular Weight | 262.06 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-(1-bromo-6-nitrocyclohexa-2,4-dien-1-yl)acetic acid |
| SMILES | O=C(O)CC1(Br)C=CC=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C8H8BrNO4/c9-8(5-7(11)12)4-2-1-3-6(8)10(13)14/h1-4,6H,5H2,(H,11,12) |
| InChIKey | JSZXNPUIKOJWLZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.06 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|