C12H20N2O8 — CID 160616467
butane-1,4-diol;[6-(hydroxymethyl)-1,6-dinitrocyclohexa-2,4-dien-1-yl]methanol (PubChem CID 160616467) has the molecular formula C12H20N2O8 and a molecular weight of 320.30 g/mol. Its IUPAC name is butane-1,4-diol;[6-(hydroxymethyl)-1,6-dinitrocyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | butane-1,4-diol;[6-(hydroxymethyl)-1,6-dinitrocyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 160616467 |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | butane-1,4-diol;[6-(hydroxymethyl)-1,6-dinitrocyclohexa-2,4-dien-1-yl]methanol |
| SMILES | O=[N+]([O-])C1(CO)C=CC=CC1(CO)[N+](=O)[O-].OCCCCO |
| InChI | InChI=1S/C8H10N2O6.C4H10O2/c11-5-7(9(13)14)3-1-2-4-8(7,6-12)10(15)16;5-3-1-2-4-6/h1-4,11-12H,5-6H2;5-6H,1-4H2 |
| InChIKey | RGDRAGNWCRWPJF-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|