C6H2F5NO3 — CID 167441498
4,4,5,5,6-pentafluoro-6-nitrocyclohex-2-en-1-one (PubChem CID 167441498) has the molecular formula C6H2F5NO3 and a molecular weight of 231.08 g/mol. Its IUPAC name is 4,4,5,5,6-pentafluoro-6-nitrocyclohex-2-en-1-one.
| Compound Name | 4,4,5,5,6-pentafluoro-6-nitrocyclohex-2-en-1-one |
|---|---|
| PubChem CID | 167441498 |
| Molecular Formula | C6H2F5NO3 |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 231.00 |
| IUPAC Name | 4,4,5,5,6-pentafluoro-6-nitrocyclohex-2-en-1-one |
| SMILES | O=C1C=CC(F)(F)C(F)(F)C1(F)[N+](=O)[O-] |
| InChI | InChI=1S/C6H2F5NO3/c7-4(8)2-1-3(13)5(9,12(14)15)6(4,10)11/h1-2H |
| InChIKey | IAZHUYRSZLKLNK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|