C17H8F8N2O6 — CID 121234638
2-nitro-4-[1,2,2,3,3,4,4,5-octafluoro-5-(4-hydroxy-3-nitrophenyl)cyclopentyl]phenol (PubChem CID 121234638) has the molecular formula C17H8F8N2O6 and a molecular weight of 488.24 g/mol. Its IUPAC name is 2-nitro-4-[1,2,2,3,3,4,4,5-octafluoro-5-(4-hydroxy-3-nitrophenyl)cyclopentyl]phenol.
| Compound Name | 2-nitro-4-[1,2,2,3,3,4,4,5-octafluoro-5-(4-hydroxy-3-nitrophenyl)cyclopentyl]phenol |
|---|---|
| PubChem CID | 121234638 |
| Molecular Formula | C17H8F8N2O6 |
| Molecular Weight | 488.24 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-nitro-4-[1,2,2,3,3,4,4,5-octafluoro-5-(4-hydroxy-3-nitrophenyl)cyclopentyl]phenol |
| SMILES | O=[N+]([O-])c1cc(C2(F)C(F)(F)C(F)(F)C(F)(F)C2(F)c2ccc(O)c([N+](=O)[O-])c2)ccc1O |
| InChI | InChI=1S/C17H8F8N2O6/c18-13(7-1-3-11(28)9(5-7)26(30)31)14(19,16(22,23)17(24,25)15(13,20)21)8-2-4-12(29)10(6-8)27(32)33/h1-6,28-29H |
| InChIKey | DCOIGPRFTMQDDZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.24 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|