C18H18N2O6 — CID 137364035
1-(4-hydroxy-3-nitrophenyl)-1,3,3-trimethyl-6-nitro-2H-inden-5-ol (PubChem CID 137364035) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is 1-(4-hydroxy-3-nitrophenyl)-1,3,3-trimethyl-6-nitro-2H-inden-5-ol.
| Compound Name | 1-(4-hydroxy-3-nitrophenyl)-1,3,3-trimethyl-6-nitro-2H-inden-5-ol |
|---|---|
| PubChem CID | 137364035 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-(4-hydroxy-3-nitrophenyl)-1,3,3-trimethyl-6-nitro-2H-inden-5-ol |
| SMILES | CC1(C)CC(C)(c2ccc(O)c([N+](=O)[O-])c2)c2cc([N+](=O)[O-])c(O)cc21 |
| InChI | InChI=1S/C18H18N2O6/c1-17(2)9-18(3,10-4-5-15(21)13(6-10)19(23)24)12-7-14(20(25)26)16(22)8-11(12)17/h4-8,21-22H,9H2,1-3H3 |
| InChIKey | SEQASCBWUPZQMY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|