C22H28O2 — CID 139711661
6-tert-butyl-3-(3-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol (PubChem CID 139711661) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 6-tert-butyl-3-(3-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol.
| Compound Name | 6-tert-butyl-3-(3-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol |
|---|---|
| PubChem CID | 139711661 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 6-tert-butyl-3-(3-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol |
| SMILES | CC(C)(C)c1cc2c(cc1O)C(C)(c1cccc(O)c1)CC2(C)C |
| InChI | InChI=1S/C22H28O2/c1-20(2,3)18-11-16-17(12-19(18)24)22(6,13-21(16,4)5)14-8-7-9-15(23)10-14/h7-12,23-24H,13H2,1-6H3 |
| InChIKey | GNVWBXOAFFJKHV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |