C21H26O3 — CID 139711668
3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol (PubChem CID 139711668) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol.
| Compound Name | 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol |
|---|---|
| PubChem CID | 139711668 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol |
| SMILES | CCCOc1cc2c(cc1O)C(C)(c1cccc(O)c1)CC2(C)C |
| InChI | InChI=1S/C21H26O3/c1-5-9-24-19-12-16-17(11-18(19)23)21(4,13-20(16,2)3)14-7-6-8-15(22)10-14/h6-8,10-12,22-23H,5,9,13H2,1-4H3 |
| InChIKey | HEJVNNMKZMCDCU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |