About 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol
3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol (PubChem CID 139711668) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol.
Molecular Properties
| Compound Name | 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol |
| PubChem CID | 139711668 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol |
| SMILES | CCCOc1cc2c(cc1O)C(C)(c1cccc(O)c1)CC2(C)C |
| InChI | InChI=1S/C21H26O3/c1-5-9-24-19-12-16-17(11-18(19)23)21(4,13-20(16,2)3)14-7-6-8-15(22)10-14/h6-8,10-12,22-23H,5,9,13H2,1-4H3 |
| InChIKey | HEJVNNMKZMCDCU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol?
The IUPAC name of 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol (CID 139711668) is 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol.
What is the SMILES notation for 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol?
The canonical SMILES for 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol is CCCOc1cc2c(cc1O)C(C)(c1cccc(O)c1)CC2(C)C.
What is the InChIKey of 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol?
The InChIKey is HEJVNNMKZMCDCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O3/c1-5-9-24-19-12-16-17(11-18(19)23)21(4,13-20(16,2)3)14-7-6-8-15(22)10-14/h6-8,10-12,22-23H,5,9,13H2,1-4H3.
What are the key properties of 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol?
3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol has a molecular weight of 326.44 g/mol, XLogP of 4.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxyphenyl)-1,1,3-trimethyl-6-propoxy-2H-inden-5-ol is sourced from PubChem (CID 139711668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).