C22H28O3 — CID 139711635
6-butoxy-3-(4-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol (PubChem CID 139711635) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is 6-butoxy-3-(4-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol.
| Compound Name | 6-butoxy-3-(4-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol |
|---|---|
| PubChem CID | 139711635 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 6-butoxy-3-(4-hydroxyphenyl)-1,1,3-trimethyl-2H-inden-5-ol |
| SMILES | CCCCOc1cc2c(cc1O)C(C)(c1ccc(O)cc1)CC2(C)C |
| InChI | InChI=1S/C22H28O3/c1-5-6-11-25-20-13-17-18(12-19(20)24)22(4,14-21(17,2)3)15-7-9-16(23)10-8-15/h7-10,12-13,23-24H,5-6,11,14H2,1-4H3 |
| InChIKey | WTOCVBDWTVXODJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|