About 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene
5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene (PubChem CID 624568) has the molecular formula C20H24O2
and a molecular weight of 296.41 g/mol. Its IUPAC name is 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene.
Molecular Properties
| Compound Name | 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene |
| PubChem CID | 624568 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene |
| SMILES | COc1ccc(C2(C)CC(C)(C)c3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C20H24O2/c1-19(2)13-20(3,14-6-8-15(21-4)9-7-14)18-12-16(22-5)10-11-17(18)19/h6-12H,13H2,1-5H3 |
| InChIKey | RKSZGJIIRCVRRQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene?
The IUPAC name of 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene (CID 624568) is 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene.
What is the SMILES notation for 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene?
The canonical SMILES for 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene is COc1ccc(C2(C)CC(C)(C)c3ccc(OC)cc32)cc1.
What is the InChIKey of 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene?
The InChIKey is RKSZGJIIRCVRRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24O2/c1-19(2)13-20(3,14-6-8-15(21-4)9-7-14)18-12-16(22-5)10-11-17(18)19/h6-12H,13H2,1-5H3.
What are the key properties of 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene?
5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene has a molecular weight of 296.41 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-(4-methoxyphenyl)-1,1,3-trimethyl-2H-indene is sourced from PubChem (CID 624568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).