C32H28O4 — CID 91744404
phenyl 1,1,3-trimethyl-3-(4-phenoxycarbonylphenyl)-2H-indene-5-carboxylate (PubChem CID 91744404) has the molecular formula C32H28O4 and a molecular weight of 476.57 g/mol. Its IUPAC name is phenyl 1,1,3-trimethyl-3-(4-phenoxycarbonylphenyl)-2H-indene-5-carboxylate.
| Compound Name | phenyl 1,1,3-trimethyl-3-(4-phenoxycarbonylphenyl)-2H-indene-5-carboxylate |
|---|---|
| PubChem CID | 91744404 |
| Molecular Formula | C32H28O4 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | phenyl 1,1,3-trimethyl-3-(4-phenoxycarbonylphenyl)-2H-indene-5-carboxylate |
| SMILES | CC1(C)CC(C)(c2ccc(C(=O)Oc3ccccc3)cc2)c2cc(C(=O)Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C32H28O4/c1-31(2)21-32(3,24-17-14-22(15-18-24)29(33)35-25-10-6-4-7-11-25)28-20-23(16-19-27(28)31)30(34)36-26-12-8-5-9-13-26/h4-20H,21H2,1-3H3 |
| InChIKey | JGOGNNMWGYZZRW-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|