C18H20S2 — CID 20706896
1,1,3-trimethyl-3-(4-sulfanylphenyl)-2H-indene-5-thiol (PubChem CID 20706896) has the molecular formula C18H20S2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 1,1,3-trimethyl-3-(4-sulfanylphenyl)-2H-indene-5-thiol.
| Compound Name | 1,1,3-trimethyl-3-(4-sulfanylphenyl)-2H-indene-5-thiol |
|---|---|
| PubChem CID | 20706896 |
| Molecular Formula | C18H20S2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1,1,3-trimethyl-3-(4-sulfanylphenyl)-2H-indene-5-thiol |
| SMILES | CC1(C)CC(C)(c2ccc(S)cc2)c2cc(S)ccc21 |
| InChI | InChI=1S/C18H20S2/c1-17(2)11-18(3,12-4-6-13(19)7-5-12)16-10-14(20)8-9-15(16)17/h4-10,19-20H,11H2,1-3H3 |
| InChIKey | GLJJJWPHTSHMIZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|