C18H22BIO2P2 — CID 159190476
CID 159190476 (PubChem CID 159190476) has the molecular formula C18H22BIO2P2 and a molecular weight of 470.04 g/mol.
| Compound Name | CID 159190476 |
|---|---|
| PubChem CID | 159190476 |
| Molecular Formula | C18H22BIO2P2 |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(C)(c2ccc(O)cc2)c2cc(O)ccc21.[B]P(P)I |
| InChI | InChI=1S/C18H20O2.BH2IP2/c1-17(2)11-18(3,12-4-6-13(19)7-5-12)16-10-14(20)8-9-15(16)17;1-4(2)3/h4-10,19-20H,11H2,1-3H3;3H2 |
| InChIKey | OHBALXOPLXNGKK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|