C29H42N2O2 — CID 165092044
1-(3-amino-4-hex-5-enoxyphenyl)-1,3,3-trimethyl-6-pentoxy-2H-inden-5-amine (PubChem CID 165092044) has the molecular formula C29H42N2O2 and a molecular weight of 450.67 g/mol. Its IUPAC name is 1-(3-amino-4-hex-5-enoxyphenyl)-1,3,3-trimethyl-6-pentoxy-2H-inden-5-amine.
| Compound Name | 1-(3-amino-4-hex-5-enoxyphenyl)-1,3,3-trimethyl-6-pentoxy-2H-inden-5-amine |
|---|---|
| PubChem CID | 165092044 |
| Molecular Formula | C29H42N2O2 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.32 |
| IUPAC Name | 1-(3-amino-4-hex-5-enoxyphenyl)-1,3,3-trimethyl-6-pentoxy-2H-inden-5-amine |
| SMILES | C=CCCCCOc1ccc(C2(C)CC(C)(C)c3cc(N)c(OCCCCC)cc32)cc1N |
| InChI | InChI=1S/C29H42N2O2/c1-6-8-10-12-16-32-26-14-13-21(17-24(26)30)29(5)20-28(3,4)22-18-25(31)27(19-23(22)29)33-15-11-9-7-2/h6,13-14,17-19H,1,7-12,15-16,20,30-31H2,2-5H3 |
| InChIKey | WWJUWTZCNPVARF-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|