C22H26O — CID 152535870
1-(4-but-3-enoxyphenyl)-1,3,3-trimethyl-2H-indene (PubChem CID 152535870) has the molecular formula C22H26O and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(4-but-3-enoxyphenyl)-1,3,3-trimethyl-2H-indene.
| Compound Name | 1-(4-but-3-enoxyphenyl)-1,3,3-trimethyl-2H-indene |
|---|---|
| PubChem CID | 152535870 |
| Molecular Formula | C22H26O |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 1-(4-but-3-enoxyphenyl)-1,3,3-trimethyl-2H-indene |
| SMILES | C=CCCOc1ccc(C2(C)CC(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H26O/c1-5-6-15-23-18-13-11-17(12-14-18)22(4)16-21(2,3)19-9-7-8-10-20(19)22/h5,7-14H,1,6,15-16H2,2-4H3 |
| InChIKey | YKMYOHYUKCXWMP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|