About 3-propoxyphenazin-2-ol
3-propoxyphenazin-2-ol (PubChem CID 175825118) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-propoxyphenazin-2-ol.
Molecular Properties
| Compound Name | 3-propoxyphenazin-2-ol |
| PubChem CID | 175825118 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-propoxyphenazin-2-ol |
| SMILES | CCCOc1cc2nc3ccccc3nc2cc1O |
| InChI | InChI=1S/C15H14N2O2/c1-2-7-19-15-9-13-12(8-14(15)18)16-10-5-3-4-6-11(10)17-13/h3-6,8-9,18H,2,7H2,1H3 |
| InChIKey | JDEQWJVKKZLEDL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxyphenazin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxyphenazin-2-ol?
The IUPAC name of 3-propoxyphenazin-2-ol (CID 175825118) is 3-propoxyphenazin-2-ol.
What is the SMILES notation for 3-propoxyphenazin-2-ol?
The canonical SMILES for 3-propoxyphenazin-2-ol is CCCOc1cc2nc3ccccc3nc2cc1O.
What is the InChIKey of 3-propoxyphenazin-2-ol?
The InChIKey is JDEQWJVKKZLEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-2-7-19-15-9-13-12(8-14(15)18)16-10-5-3-4-6-11(10)17-13/h3-6,8-9,18H,2,7H2,1H3.
What are the key properties of 3-propoxyphenazin-2-ol?
3-propoxyphenazin-2-ol has a molecular weight of 254.29 g/mol, XLogP of 3.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxyphenazin-2-ol is sourced from PubChem (CID 175825118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).