C20H24O2 — CID 139711675
1-(4-hydroxy-3-methylphenyl)-1,3,3,7-tetramethyl-2H-inden-5-ol (PubChem CID 139711675) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methylphenyl)-1,3,3,7-tetramethyl-2H-inden-5-ol.
| Compound Name | 1-(4-hydroxy-3-methylphenyl)-1,3,3,7-tetramethyl-2H-inden-5-ol |
|---|---|
| PubChem CID | 139711675 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-(4-hydroxy-3-methylphenyl)-1,3,3,7-tetramethyl-2H-inden-5-ol |
| SMILES | Cc1cc(C2(C)CC(C)(C)c3cc(O)cc(C)c32)ccc1O |
| InChI | InChI=1S/C20H24O2/c1-12-8-14(6-7-17(12)22)20(5)11-19(3,4)16-10-15(21)9-13(2)18(16)20/h6-10,21-22H,11H2,1-5H3 |
| InChIKey | CFFYQMHBZUDLBK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |