C13H17NO3 — CID 12555406
1,1,3,3-tetramethyl-4-nitro-2H-inden-5-ol (PubChem CID 12555406) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-4-nitro-2H-inden-5-ol.
| Compound Name | 1,1,3,3-tetramethyl-4-nitro-2H-inden-5-ol |
|---|---|
| PubChem CID | 12555406 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1,1,3,3-tetramethyl-4-nitro-2H-inden-5-ol |
| SMILES | CC1(C)CC(C)(C)c2c1ccc(O)c2[N+](=O)[O-] |
| InChI | InChI=1S/C13H17NO3/c1-12(2)7-13(3,4)10-8(12)5-6-9(15)11(10)14(16)17/h5-6,15H,7H2,1-4H3 |
| InChIKey | RSAWWVDNYLBVNB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|