C14H18N2O4 — CID 139709746
1,1,4,4-tetramethyl-5,6-dinitro-2,3-dihydronaphthalene (PubChem CID 139709746) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-5,6-dinitro-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-5,6-dinitro-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 139709746 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 1,1,4,4-tetramethyl-5,6-dinitro-2,3-dihydronaphthalene |
| SMILES | CC1(C)CCC(C)(C)c2c1ccc([N+](=O)[O-])c2[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O4/c1-13(2)7-8-14(3,4)11-9(13)5-6-10(15(17)18)12(11)16(19)20/h5-6H,7-8H2,1-4H3 |
| InChIKey | VFCBVEHGVFKPIA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|