C24H27NO5 — CID 143004624
methyl 4-(3,5,5,8,8-pentamethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl)benzoate (PubChem CID 143004624) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is methyl 4-(3,5,5,8,8-pentamethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl)benzoate.
| Compound Name | methyl 4-(3,5,5,8,8-pentamethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 143004624 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methyl 4-(3,5,5,8,8-pentamethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)c2cc3c(c([N+](=O)[O-])c2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-14-17(21(26)15-7-9-16(10-8-15)22(27)30-6)13-18-19(20(14)25(28)29)24(4,5)12-11-23(18,2)3/h7-10,13H,11-12H2,1-6H3 |
| InChIKey | QPUWDWDTCHHDPM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|