C23H25BrN2O5 — CID 23001759
methyl 4-[(4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]-2-nitrobenzoate (PubChem CID 23001759) has the molecular formula C23H25BrN2O5 and a molecular weight of 489.37 g/mol. Its IUPAC name is methyl 4-[(4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]-2-nitrobenzoate.
| Compound Name | methyl 4-[(4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]-2-nitrobenzoate |
|---|---|
| PubChem CID | 23001759 |
| Molecular Formula | C23H25BrN2O5 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | methyl 4-[(4-bromo-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]-2-nitrobenzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cc(Br)c3c(c2)C(C)(C)CCC3(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H25BrN2O5/c1-22(2)8-9-23(3,4)19-16(22)11-14(12-17(19)24)25-20(27)13-6-7-15(21(28)31-5)18(10-13)26(29)30/h6-7,10-12H,8-9H2,1-5H3,(H,25,27) |
| InChIKey | MKKQNGQKIJXXRU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|