C28H26FNO5 — CID 143004633
4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl]benzoic acid (PubChem CID 143004633) has the molecular formula C28H26FNO5 and a molecular weight of 475.52 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl]benzoic acid.
| Compound Name | 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 143004633 |
| Molecular Formula | C28H26FNO5 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-5,5,8,8-tetramethyl-4-nitro-6,7-dihydronaphthalene-2-carbonyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2c1cc(C(=O)c1ccc(C(=O)O)cc1)c(-c1ccccc1F)c2[N+](=O)[O-] |
| InChI | InChI=1S/C28H26FNO5/c1-27(2)13-14-28(3,4)23-20(27)15-19(25(31)16-9-11-17(12-10-16)26(32)33)22(24(23)30(34)35)18-7-5-6-8-21(18)29/h5-12,15H,13-14H2,1-4H3,(H,32,33) |
| InChIKey | DGJYTCGUEHDRGX-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|