C45H66N2O2 — CID 158771702
3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene;1,1,4,4,6-pentamethyl-7-nitro-2,3-dihydronaphthalene (PubChem CID 158771702) has the molecular formula C45H66N2O2 and a molecular weight of 667.04 g/mol. Its IUPAC name is 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene;1,1,4,4,6-pentamethyl-7-nitro-2,3-dihydronaphthalene.
| Compound Name | 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene;1,1,4,4,6-pentamethyl-7-nitro-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 158771702 |
| Molecular Formula | C45H66N2O2 |
| Molecular Weight | 667.04 g/mol |
| Exact Mass | 666.51 |
| IUPAC Name | 3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-amine;1,1,4,4,6-pentamethyl-2,3-dihydronaphthalene;1,1,4,4,6-pentamethyl-7-nitro-2,3-dihydronaphthalene |
| SMILES | Cc1cc2c(cc1N)C(C)(C)CCC2(C)C.Cc1cc2c(cc1[N+](=O)[O-])C(C)(C)CCC2(C)C.Cc1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C15H21NO2.C15H23N.C15H22/c1-10-8-11-12(9-13(10)16(17)18)15(4,5)7-6-14(11,2)3;1-10-8-11-12(9-13(10)16)15(4,5)7-6-14(11,2)3;1-11-6-7-12-13(10-11)15(4,5)9-8-14(12,2)3/h8-9H,6-7H2,1-5H3;8-9H,6-7,16H2,1-5H3;6-7,10H,8-9H2,1-5H3 |
| InChIKey | IPYHYAFWAZIXIM-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.04 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|