C22H28N2O2 — CID 10713006
N-ethyl-5,5,8,8-tetramethyl-N-(2-nitrophenyl)-6,7-dihydronaphthalen-2-amine (PubChem CID 10713006) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-ethyl-5,5,8,8-tetramethyl-N-(2-nitrophenyl)-6,7-dihydronaphthalen-2-amine.
| Compound Name | N-ethyl-5,5,8,8-tetramethyl-N-(2-nitrophenyl)-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 10713006 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-ethyl-5,5,8,8-tetramethyl-N-(2-nitrophenyl)-6,7-dihydronaphthalen-2-amine |
| SMILES | CCN(c1ccc2c(c1)C(C)(C)CCC2(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O2/c1-6-23(19-9-7-8-10-20(19)24(25)26)16-11-12-17-18(15-16)22(4,5)14-13-21(17,2)3/h7-12,15H,6,13-14H2,1-5H3 |
| InChIKey | PMEYPHODLYDMEE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|