C20H23NO3 — CID 10616047
1,1,4,4-tetramethyl-6-(2-nitrophenoxy)-2,3-dihydronaphthalene (PubChem CID 10616047) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-6-(2-nitrophenoxy)-2,3-dihydronaphthalene.
| Compound Name | 1,1,4,4-tetramethyl-6-(2-nitrophenoxy)-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 10616047 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | 1,1,4,4-tetramethyl-6-(2-nitrophenoxy)-2,3-dihydronaphthalene |
| SMILES | CC1(C)CCC(C)(C)c2cc(Oc3ccccc3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H23NO3/c1-19(2)11-12-20(3,4)16-13-14(9-10-15(16)19)24-18-8-6-5-7-17(18)21(22)23/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | DGSKXQJBXZPIQG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|