C20H22N2O3 — CID 139767842
5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-8-nitro-1,2,3,4-tetrahydro-3-benzazepin-7-ol (PubChem CID 139767842) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-8-nitro-1,2,3,4-tetrahydro-3-benzazepin-7-ol.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-8-nitro-1,2,3,4-tetrahydro-3-benzazepin-7-ol |
|---|---|
| PubChem CID | 139767842 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-5-methyl-8-nitro-1,2,3,4-tetrahydro-3-benzazepin-7-ol |
| SMILES | CC1(c2ccc3c(c2)CCC3)CNCCc2cc([N+](=O)[O-])c(O)cc21 |
| InChI | InChI=1S/C20H22N2O3/c1-20(16-6-5-13-3-2-4-14(13)9-16)12-21-8-7-15-10-18(22(24)25)19(23)11-17(15)20/h5-6,9-11,21,23H,2-4,7-8,12H2,1H3 |
| InChIKey | WHDZYLOBMGFWDD-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|