About 7-bromo-6-nitro-2,3-dihydro-1H-indole
7-bromo-6-nitro-2,3-dihydro-1H-indole (PubChem CID 21338909) has the molecular formula C8H7BrN2O2
and a molecular weight of 243.06 g/mol. Its IUPAC name is 7-bromo-6-nitro-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 7-bromo-6-nitro-2,3-dihydro-1H-indole |
| PubChem CID | 21338909 |
| Molecular Formula | C8H7BrN2O2 |
| Molecular Weight | 243.06 g/mol |
| Exact Mass | 241.97 |
| IUPAC Name | 7-bromo-6-nitro-2,3-dihydro-1H-indole |
| SMILES | O=[N+]([O-])c1ccc2c(c1Br)NCC2 |
| InChI | InChI=1S/C8H7BrN2O2/c9-7-6(11(12)13)2-1-5-3-4-10-8(5)7/h1-2,10H,3-4H2 |
| InChIKey | WYBVLAZPMWLPGV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.06 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-6-nitro-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-6-nitro-2,3-dihydro-1H-indole?
The IUPAC name of 7-bromo-6-nitro-2,3-dihydro-1H-indole (CID 21338909) is 7-bromo-6-nitro-2,3-dihydro-1H-indole.
What is the SMILES notation for 7-bromo-6-nitro-2,3-dihydro-1H-indole?
The canonical SMILES for 7-bromo-6-nitro-2,3-dihydro-1H-indole is O=[N+]([O-])c1ccc2c(c1Br)NCC2.
What is the InChIKey of 7-bromo-6-nitro-2,3-dihydro-1H-indole?
The InChIKey is WYBVLAZPMWLPGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2O2/c9-7-6(11(12)13)2-1-5-3-4-10-8(5)7/h1-2,10H,3-4H2.
What are the key properties of 7-bromo-6-nitro-2,3-dihydro-1H-indole?
7-bromo-6-nitro-2,3-dihydro-1H-indole has a molecular weight of 243.06 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-6-nitro-2,3-dihydro-1H-indole is sourced from PubChem (CID 21338909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).