About 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline
6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline (PubChem CID 133055063) has the molecular formula C9H9IN2O2
and a molecular weight of 304.09 g/mol. Its IUPAC name is 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline.
Molecular Properties
| Compound Name | 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline |
| PubChem CID | 133055063 |
| Molecular Formula | C9H9IN2O2 |
| Molecular Weight | 304.09 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline |
| SMILES | O=[N+]([O-])c1cc(I)cc2c1NCCC2 |
| InChI | InChI=1S/C9H9IN2O2/c10-7-4-6-2-1-3-11-9(6)8(5-7)12(13)14/h4-5,11H,1-3H2 |
| InChIKey | CIDVOOFXDNXSMH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.09 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline?
The IUPAC name of 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline (CID 133055063) is 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline.
What is the SMILES notation for 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline?
The canonical SMILES for 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline is O=[N+]([O-])c1cc(I)cc2c1NCCC2.
What is the InChIKey of 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline?
The InChIKey is CIDVOOFXDNXSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN2O2/c10-7-4-6-2-1-3-11-9(6)8(5-7)12(13)14/h4-5,11H,1-3H2.
What are the key properties of 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline?
6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline has a molecular weight of 304.09 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-8-nitro-1,2,3,4-tetrahydroquinoline is sourced from PubChem (CID 133055063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).