C9H10N3O7+ — CID 87541095
N-hydroxy-4,4-dimethoxy-3,3-dinitrocyclohexa-1,5-diene-1-carbonitrilium (PubChem CID 87541095) has the molecular formula C9H10N3O7+ and a molecular weight of 272.19 g/mol. Its IUPAC name is N-hydroxy-4,4-dimethoxy-3,3-dinitrocyclohexa-1,5-diene-1-carbonitrilium.
| Compound Name | N-hydroxy-4,4-dimethoxy-3,3-dinitrocyclohexa-1,5-diene-1-carbonitrilium |
|---|---|
| PubChem CID | 87541095 |
| Molecular Formula | C9H10N3O7+ |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | N-hydroxy-4,4-dimethoxy-3,3-dinitrocyclohexa-1,5-diene-1-carbonitrilium |
| SMILES | COC1(OC)C=CC(C#[N+]O)=CC1([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C9H9N3O7/c1-18-9(19-2)4-3-7(6-10-13)5-8(9,11(14)15)12(16)17/h3-5H,1-2H3/p+1 |
| InChIKey | YGYOAQCJWSSOOG-UHFFFAOYSA-O |
| XLogP | 0.44 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|