C14H21NO3 — CID 143025576
[4-(2,2-dimethylpropyl)-1-methylcyclohepta-2,4,6-trien-1-yl]methyl nitrate (PubChem CID 143025576) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)-1-methylcyclohepta-2,4,6-trien-1-yl]methyl nitrate.
| Compound Name | [4-(2,2-dimethylpropyl)-1-methylcyclohepta-2,4,6-trien-1-yl]methyl nitrate |
|---|---|
| PubChem CID | 143025576 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | [4-(2,2-dimethylpropyl)-1-methylcyclohepta-2,4,6-trien-1-yl]methyl nitrate |
| SMILES | CC(C)(C)CC1=CC=CC(C)(CO[N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C14H21NO3/c1-13(2,3)10-12-6-5-8-14(4,9-7-12)11-18-15(16)17/h5-9H,10-11H2,1-4H3 |
| InChIKey | RVDWDMYPSNPUKG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|