C11H11NO2 — CID 163442833
(1E,5Z,7Z,9Z)-2-nitrocycloundeca-1,3,5,7,9-pentaene (PubChem CID 163442833) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (1E,5Z,7Z,9Z)-2-nitrocycloundeca-1,3,5,7,9-pentaene.
| Compound Name | (1E,5Z,7Z,9Z)-2-nitrocycloundeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 163442833 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (1E,5Z,7Z,9Z)-2-nitrocycloundeca-1,3,5,7,9-pentaene |
| SMILES | O=[N+]([O-])/C1=C/C/C=C\C=C/C=C\C=C1 |
| InChI | InChI=1S/C11H11NO2/c13-12(14)11-9-7-5-3-1-2-4-6-8-10-11/h1-7,9-10H,8H2/b2-1-,5-3-,6-4-,9-7?,11-10+ |
| InChIKey | AZZJVZLIYFXUTH-DVMANTRHSA-N |
| XLogP | 2.78 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|