C7H5NO2 — CID 71417334
1-nitrocyclohepta-1,2,4,6-tetraene (PubChem CID 71417334) has the molecular formula C7H5NO2 and a molecular weight of 135.12 g/mol. Its IUPAC name is 1-nitrocyclohepta-1,2,4,6-tetraene.
| Compound Name | 1-nitrocyclohepta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 71417334 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 1-nitrocyclohepta-1,2,4,6-tetraene |
| SMILES | O=[N+]([O-])C1=C=CC=CC=C1 |
| InChI | InChI=1S/C7H5NO2/c9-8(10)7-5-3-1-2-4-6-7/h1-5H |
| InChIKey | UXZZWLGTGHFAMY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|