About 2-nitro-1H-arsole
2-nitro-1H-arsole (PubChem CID 173346715) has the molecular formula C4H4AsNO2
and a molecular weight of 173.00 g/mol. Its IUPAC name is 2-nitro-1H-arsole.
Molecular Properties
| Compound Name | 2-nitro-1H-arsole |
| PubChem CID | 173346715 |
| Molecular Formula | C4H4AsNO2 |
| Molecular Weight | 173.00 g/mol |
| Exact Mass | 172.95 |
| IUPAC Name | 2-nitro-1H-arsole |
| SMILES | O=[N+]([O-])C1=CC=C[AsH]1 |
| InChI | InChI=1S/C4H4AsNO2/c7-6(8)4-2-1-3-5-4/h1-3,5H |
| InChIKey | FDWREGZKEBDXEF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.00 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1H-arsole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1H-arsole?
The IUPAC name of 2-nitro-1H-arsole (CID 173346715) is 2-nitro-1H-arsole.
What is the SMILES notation for 2-nitro-1H-arsole?
The canonical SMILES for 2-nitro-1H-arsole is O=[N+]([O-])C1=CC=C[AsH]1.
What is the InChIKey of 2-nitro-1H-arsole?
The InChIKey is FDWREGZKEBDXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4AsNO2/c7-6(8)4-2-1-3-5-4/h1-3,5H.
What are the key properties of 2-nitro-1H-arsole?
2-nitro-1H-arsole has a molecular weight of 173.00 g/mol, XLogP of 0.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1H-arsole is sourced from PubChem (CID 173346715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).