C7H5Cl2NO3 — CID 131014118
(3,6-dichloro-2-nitrophenyl)methanol (PubChem CID 131014118) has the molecular formula C7H5Cl2NO3 and a molecular weight of 222.03 g/mol. Its IUPAC name is (3,6-dichloro-2-nitrophenyl)methanol.
| Compound Name | (3,6-dichloro-2-nitrophenyl)methanol |
|---|---|
| PubChem CID | 131014118 |
| Molecular Formula | C7H5Cl2NO3 |
| Molecular Weight | 222.03 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | (3,6-dichloro-2-nitrophenyl)methanol |
| SMILES | O=[N+]([O-])c1c(Cl)ccc(Cl)c1CO |
| InChI | InChI=1S/C7H5Cl2NO3/c8-5-1-2-6(9)7(10(12)13)4(5)3-11/h1-2,11H,3H2 |
| InChIKey | UOFIPZWQYGTFSU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.03 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|