C9H5F6NO3 — CID 134638915
[2-nitro-3,6-bis(trifluoromethyl)phenyl]methanol (PubChem CID 134638915) has the molecular formula C9H5F6NO3 and a molecular weight of 289.13 g/mol. Its IUPAC name is [2-nitro-3,6-bis(trifluoromethyl)phenyl]methanol.
| Compound Name | [2-nitro-3,6-bis(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 134638915 |
| Molecular Formula | C9H5F6NO3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | [2-nitro-3,6-bis(trifluoromethyl)phenyl]methanol |
| SMILES | O=[N+]([O-])c1c(C(F)(F)F)ccc(C(F)(F)F)c1CO |
| InChI | InChI=1S/C9H5F6NO3/c10-8(11,12)5-1-2-6(9(13,14)15)7(16(18)19)4(5)3-17/h1-2,17H,3H2 |
| InChIKey | IDWPRIRGTYLJKR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|