C11H12F3N3O6 — CID 21147509
2-[N-(2-hydroxyethyl)-2,3-dinitro-4-(trifluoromethyl)anilino]ethanol (PubChem CID 21147509) has the molecular formula C11H12F3N3O6 and a molecular weight of 339.23 g/mol. Its IUPAC name is 2-[N-(2-hydroxyethyl)-2,3-dinitro-4-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[N-(2-hydroxyethyl)-2,3-dinitro-4-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 21147509 |
| Molecular Formula | C11H12F3N3O6 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-[N-(2-hydroxyethyl)-2,3-dinitro-4-(trifluoromethyl)anilino]ethanol |
| SMILES | O=[N+]([O-])c1c(N(CCO)CCO)ccc(C(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12F3N3O6/c12-11(13,14)7-1-2-8(15(3-5-18)4-6-19)10(17(22)23)9(7)16(20)21/h1-2,18-19H,3-6H2 |
| InChIKey | DRHUFBPEDKGJJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|