C12H14F3NO4 — CID 22590154
4-[bis(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzoic acid (PubChem CID 22590154) has the molecular formula C12H14F3NO4 and a molecular weight of 293.24 g/mol. Its IUPAC name is 4-[bis(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[bis(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 22590154 |
| Molecular Formula | C12H14F3NO4 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 4-[bis(2-hydroxyethyl)amino]-3-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(N(CCO)CCO)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO4/c13-12(14,15)9-7-8(11(19)20)1-2-10(9)16(3-5-17)4-6-18/h1-2,7,17-18H,3-6H2,(H,19,20) |
| InChIKey | LOWOQPAIOPQUNV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |