C11H13BrF3NO — CID 65483629
2-[4-bromo-N-ethyl-2-(trifluoromethyl)anilino]ethanol (PubChem CID 65483629) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 2-[4-bromo-N-ethyl-2-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[4-bromo-N-ethyl-2-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 65483629 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-[4-bromo-N-ethyl-2-(trifluoromethyl)anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO/c1-2-16(5-6-17)10-4-3-8(12)7-9(10)11(13,14)15/h3-4,7,17H,2,5-6H2,1H3 |
| InChIKey | HAIHAWAMZTXCTI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |