C14H17BrF3NO2 — CID 65483634
ethyl 2-[4-bromo-N-propyl-2-(trifluoromethyl)anilino]acetate (PubChem CID 65483634) has the molecular formula C14H17BrF3NO2 and a molecular weight of 368.19 g/mol. Its IUPAC name is ethyl 2-[4-bromo-N-propyl-2-(trifluoromethyl)anilino]acetate.
| Compound Name | ethyl 2-[4-bromo-N-propyl-2-(trifluoromethyl)anilino]acetate |
|---|---|
| PubChem CID | 65483634 |
| Molecular Formula | C14H17BrF3NO2 |
| Molecular Weight | 368.19 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | ethyl 2-[4-bromo-N-propyl-2-(trifluoromethyl)anilino]acetate |
| SMILES | CCCN(CC(=O)OCC)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H17BrF3NO2/c1-3-7-19(9-13(20)21-4-2)12-6-5-10(15)8-11(12)14(16,17)18/h5-6,8H,3-4,7,9H2,1-2H3 |
| InChIKey | HQKQYTDDBYWIQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.19 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |