C12H17F3N2O — CID 54879996
2-[2-(aminomethyl)-N-ethyl-4-(trifluoromethyl)anilino]ethanol (PubChem CID 54879996) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-N-ethyl-4-(trifluoromethyl)anilino]ethanol.
| Compound Name | 2-[2-(aminomethyl)-N-ethyl-4-(trifluoromethyl)anilino]ethanol |
|---|---|
| PubChem CID | 54879996 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 2-[2-(aminomethyl)-N-ethyl-4-(trifluoromethyl)anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C12H17F3N2O/c1-2-17(5-6-18)11-4-3-10(12(13,14)15)7-9(11)8-16/h3-4,7,18H,2,5-6,8,16H2,1H3 |
| InChIKey | PKRBDTYRXUYKNN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |