C13H18F3N3O — CID 115911072
3-[2-(aminomethyl)-4-(trifluoromethyl)phenyl]-1,1-diethylurea (PubChem CID 115911072) has the molecular formula C13H18F3N3O and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[2-(aminomethyl)-4-(trifluoromethyl)phenyl]-1,1-diethylurea.
| Compound Name | 3-[2-(aminomethyl)-4-(trifluoromethyl)phenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 115911072 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-[2-(aminomethyl)-4-(trifluoromethyl)phenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)Nc1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C13H18F3N3O/c1-3-19(4-2)12(20)18-11-6-5-10(13(14,15)16)7-9(11)8-17/h5-7H,3-4,8,17H2,1-2H3,(H,18,20) |
| InChIKey | MUGRONUUSGGPSL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |