C11H15F3N2 — CID 62103801
2-(aminomethyl)-N-propan-2-yl-4-(trifluoromethyl)aniline (PubChem CID 62103801) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-(aminomethyl)-N-propan-2-yl-4-(trifluoromethyl)aniline.
| Compound Name | 2-(aminomethyl)-N-propan-2-yl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 62103801 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-(aminomethyl)-N-propan-2-yl-4-(trifluoromethyl)aniline |
| SMILES | CC(C)Nc1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C11H15F3N2/c1-7(2)16-10-4-3-9(11(12,13)14)5-8(10)6-15/h3-5,7,16H,6,15H2,1-2H3 |
| InChIKey | PIPAUPIPQWXGPE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |