C12H18F3N3O2S — CID 114813987
2-(aminomethyl)-N-(2-methylpropylsulfamoyl)-4-(trifluoromethyl)aniline (PubChem CID 114813987) has the molecular formula C12H18F3N3O2S and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-methylpropylsulfamoyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-(aminomethyl)-N-(2-methylpropylsulfamoyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 114813987 |
| Molecular Formula | C12H18F3N3O2S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 2-(aminomethyl)-N-(2-methylpropylsulfamoyl)-4-(trifluoromethyl)aniline |
| SMILES | CC(C)CNS(=O)(=O)Nc1ccc(C(F)(F)F)cc1CN |
| InChI | InChI=1S/C12H18F3N3O2S/c1-8(2)7-17-21(19,20)18-11-4-3-10(12(13,14)15)5-9(11)6-16/h3-5,8,17-18H,6-7,16H2,1-2H3 |
| InChIKey | RQGKXDBBUNSBKV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |